Products 153493-52-8

CAS 153493-52-8 appears in our catalog under these names: 1,1–Cyclopropanedimethanol cyclic sulfite, 5,7-dioxa-6-thiaspiro(2.5)octane-6,6-dione, 5,7-Dioxa-6-thiaspiro[2.5]octane 6,6-dioxide, 95%, 95%, 5,7-Dioxa-6-thiaspiro[2.5]octane 6,6-dioxide, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

5,7-dioxa-6lambda6-thiaspiro[2.5]octane 6,6-dioxide (CAS 153493-52-8) is a chemical compound with the molecular formula C5H8O4S and a molecular weight of 164.18 g/mol. IUPAC name: 5,7-dioxa-6lambda6-thiaspiro[2.5]octane 6,6-dioxide. InChIKey: JIIABAJOYJJDQW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8O4S
Molecular weight164.18 g/mol
IUPAC name5,7-dioxa-6lambda6-thiaspiro[2.5]octane 6,6-dioxide
InChIKeyJIIABAJOYJJDQW-UHFFFAOYSA-N
SMILESC1CC12COS(=O)(=O)OC2

Computed by PubChem (NCBI)