Products 2119498-60-9

CAS 2119498-60-9 is the registry number for Methyl thietane-3-carboxylate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 1,1-dioxothietane-3-carboxylate (CAS 2119498-60-9) is a chemical compound with the molecular formula C5H8O4S and a molecular weight of 164.18 g/mol. IUPAC name: methyl 1,1-dioxothietane-3-carboxylate. InChIKey: SIDIZIMCPMVBKA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8O4S
Molecular weight164.18 g/mol
IUPAC namemethyl 1,1-dioxothietane-3-carboxylate
InChIKeySIDIZIMCPMVBKA-UHFFFAOYSA-N
SMILESCOC(=O)C1CS(=O)(=O)C1

Computed by PubChem (NCBI)