Products 4785-67-5

CAS 4785-67-5 appears in our catalog under these names: Tetrahydrothiophene-3-carboxylic acid 1,1-dioxide, 95%, Tetrahydrothiophene-3-carboxylic acid 1,1-dioxide, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1,1-dioxothiolane-3-carboxylic acid (CAS 4785-67-5) is a chemical compound with the molecular formula C5H8O4S and a molecular weight of 164.18 g/mol. IUPAC name: 1,1-dioxothiolane-3-carboxylic acid. InChIKey: ASRQWTBGINUTIX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8O4S
Molecular weight164.18 g/mol
IUPAC name1,1-dioxothiolane-3-carboxylic acid
InChIKeyASRQWTBGINUTIX-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1C(=O)O

Computed by PubChem (NCBI)