Products 153614-61-0
CAS 153614-61-0 appears in our catalog under these names: Pentafluorobenzyl acrylate, 95%, (Perfluorophenyl)methyl acrylate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[difluoro-(2,3,4-trifluorophenyl)methyl] prop-2-enoate (CAS 153614-61-0) is a chemical compound with the molecular formula C10H5F5O2 and a molecular weight of 252.14 g/mol. IUPAC name: [difluoro-(2,3,4-trifluorophenyl)methyl] prop-2-enoate. InChIKey: VHZTUYUTKIOVAD-UHFFFAOYSA-N.
| Molecular formula | C10H5F5O2 |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | [difluoro-(2,3,4-trifluorophenyl)methyl] prop-2-enoate |
| InChIKey | VHZTUYUTKIOVAD-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC(C1=C(C(=C(C=C1)F)F)F)(F)F |
Computed by PubChem (NCBI)