Products 53841-60-4
CAS 53841-60-4 appears in our catalog under these names: 2-(Pentafluoropropenyl)benzoate, 95%, Perfluoroprop-1-en-2-yl benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
1,1,3,3,3-pentafluoroprop-1-en-2-yl benzoate (CAS 53841-60-4) is a chemical compound with the molecular formula C10H5F5O2 and a molecular weight of 252.14 g/mol. IUPAC name: 1,1,3,3,3-pentafluoroprop-1-en-2-yl benzoate. InChIKey: TYASJMIZETTWMA-UHFFFAOYSA-N.
| Molecular formula | C10H5F5O2 |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | 1,1,3,3,3-pentafluoroprop-1-en-2-yl benzoate |
| InChIKey | TYASJMIZETTWMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC(=C(F)F)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
pentafluoroprop-1-en-2-yl benzoate, Perfluoroprop-1-en-2-yl benzoate, 1,1,3,3,3-pentafluoroprop-1-en-2-yl Benzoate, (3s,4s)-4-(3-isopropoxyphenyl)-3,4-dimethylpiperidin-1-yl benzoate, 2,2-difluoro-1-(trifluoromethyl)vinyl benzoate, 1,1,3,3,3-pentafluoropropen-2-yl benzoate, [2,2-difluoro-1-(trifluoromethyl)vinyl] benzoate, benzoic acid [2,2-difluoro-1-(trifluoromethyl)-vinyl] ester