CAS 64287-18-9 is the registry number for 1-(2,4-Difluorobenzoyl)-3,3,3-trifluoroacetone, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1-(2,4-difluorophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 64287-18-9) is a chemical compound with the molecular formula C10H5F5O2 and a molecular weight of 252.14 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: LGWBBQQVIRAQAS-UHFFFAOYSA-N.
| Molecular formula | C10H5F5O2 |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | LGWBBQQVIRAQAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)