CAS 851901-84-3 is the registry number for 9-Bromo-10-phenylphenanthrene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
9-bromo-10-phenylphenanthrene (CAS 851901-84-3) is a chemical compound with the molecular formula C20H13Br and a molecular weight of 333.2 g/mol. IUPAC name: 9-bromo-10-phenylphenanthrene. InChIKey: SUOFIJSHPREXTC-UHFFFAOYSA-N.
| Molecular formula | C20H13Br |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 9-bromo-10-phenylphenanthrene |
| InChIKey | SUOFIJSHPREXTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C4=CC=CC=C42)Br |
Computed by PubChem (NCBI)