Products 1536436-09-5
CAS 1536436-09-5 is the registry number for 6-Bromo-8-chloro-3,4-dihydro-2H-1,4-benzoxazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-8-chloro-3,4-dihydro-2H-1,4-benzoxazine (CAS 1536436-09-5) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 6-bromo-8-chloro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: RPUCEFZYJYIUCI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 6-bromo-8-chloro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | RPUCEFZYJYIUCI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)