Products 15368-72-6

CAS 15368-72-6 is the registry number for N-Methyl L-Z-Phenylalaninamide, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 15368-72-6) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: benzyl N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: DEDOGCUYHOPZPD-INIZCTEOSA-N.

Identity
Molecular formulaC18H20N2O3
Molecular weight312.4 g/mol
IUPAC namebenzyl N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]carbamate
InChIKeyDEDOGCUYHOPZPD-INIZCTEOSA-N
SMILESCNC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)