Products 4629-50-9
CAS 4629-50-9 appears in our catalog under these names: 3-Dimethylaminobenzoic anhydride, 95%, (3-Dimethylaminobenzoyl) 3-dimethylaminobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
[3-(dimethylamino)benzoyl] 3-(dimethylamino)benzoate (CAS 4629-50-9) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: [3-(dimethylamino)benzoyl] 3-(dimethylamino)benzoate. InChIKey: ROXBMXDDDMXDFQ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | [3-(dimethylamino)benzoyl] 3-(dimethylamino)benzoate |
| InChIKey | ROXBMXDDDMXDFQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC(=C1)C(=O)OC(=O)C2=CC(=CC=C2)N(C)C |
Computed by PubChem (NCBI)