Products 2489-19-2

CAS 2489-19-2 is the registry number for N-(Benzyloxycarbonyl)-L-alanine benzylamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 500g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]carbamate (CAS 2489-19-2) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: benzyl N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]carbamate. InChIKey: WYFYJIYTOARNTF-AWEZNQCLSA-N.

Identity
Molecular formulaC18H20N2O3
Molecular weight312.4 g/mol
IUPAC namebenzyl N-[(2S)-1-(benzylamino)-1-oxopropan-2-yl]carbamate
InChIKeyWYFYJIYTOARNTF-AWEZNQCLSA-N
SMILESC[C@@H](C(=O)NCC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)