Products 15373-33-8

CAS 15373-33-8 is the registry number for (3,4-Bis(benzyloxy)phenyl)acetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-[3,4-bis(phenylmethoxy)phenyl]acetate (CAS 15373-33-8) is a chemical compound with the molecular formula C23H22O4 and a molecular weight of 362.4 g/mol. IUPAC name: methyl 2-[3,4-bis(phenylmethoxy)phenyl]acetate. InChIKey: AXVNASNMWOTDCW-UHFFFAOYSA-N.

Identity
Molecular formulaC23H22O4
Molecular weight362.4 g/mol
IUPAC namemethyl 2-[3,4-bis(phenylmethoxy)phenyl]acetate
InChIKeyAXVNASNMWOTDCW-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC(=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)