Products 2249696-72-6
CAS 2249696-72-6 is the registry number for Progerinin, 99.74%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 50 mg, 25 mg, 10 mg.
(3S)-2,2-dimethyl-3-[(E)-3-phenylprop-2-enoxy]-3,4-dihydropyrano[3,2-g]chromen-8-one (CAS 2249696-72-6) is a chemical compound with the molecular formula C23H22O4 and a molecular weight of 362.4 g/mol. IUPAC name: (3S)-2,2-dimethyl-3-[(E)-3-phenylprop-2-enoxy]-3,4-dihydropyrano[3,2-g]chromen-8-one. InChIKey: KTTIANPTCWGYCN-JLXBBBJOSA-N.
| Molecular formula | C23H22O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (3S)-2,2-dimethyl-3-[(E)-3-phenylprop-2-enoxy]-3,4-dihydropyrano[3,2-g]chromen-8-one |
| InChIKey | KTTIANPTCWGYCN-JLXBBBJOSA-N |
| SMILES | CC1([C@H](CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)OC/C=C/C4=CC=CC=C4)C |
Computed by PubChem (NCBI)