Products 50841-46-8
CAS 50841-46-8 appears in our catalog under these names: Terbutaline Sulphate Impurity 50, Terbutaline Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 3,5-bis(phenylmethoxy)benzoate (CAS 50841-46-8) is a chemical compound with the molecular formula C23H22O4 and a molecular weight of 362.4 g/mol. IUPAC name: ethyl 3,5-bis(phenylmethoxy)benzoate. InChIKey: RQXAEHUFPQJLDD-UHFFFAOYSA-N.
| Molecular formula | C23H22O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | ethyl 3,5-bis(phenylmethoxy)benzoate |
| InChIKey | RQXAEHUFPQJLDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 3,5-bis(benzyloxy)benzoate, ethyl 3,5-bis(phenylmethoxy)benzoate, ethyl 3,5-dibenzyloxybenzoate, 3,5-Bis-benzyloxy-benzoic acid ethyl ester, Benzoic acid,3,5-bis(phenylmethoxy)-, ethyl ester, Ethyl-3,5-dibenzyloxy-benzoate, Terbutaline Sulphate Impurity 50, Benzoic acid, 3,5-bis(phenylmethoxy)-, ethyl ester