CAS 1537310-13-6 is the registry number for tert-Butyl 3-chloro-5-nitrobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-chloro-5-nitrobenzoate (CAS 1537310-13-6) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: tert-butyl 3-chloro-5-nitrobenzoate. InChIKey: BFUVXEQMSOGOJX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | tert-butyl 3-chloro-5-nitrobenzoate |
| InChIKey | BFUVXEQMSOGOJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)