CAS 250790-05-7 is the registry number for tert-Butyl 2-chloro-4-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-chloro-4-nitrobenzoate (CAS 250790-05-7) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: tert-butyl 2-chloro-4-nitrobenzoate. InChIKey: AWGXKDKZWXJTFT-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | tert-butyl 2-chloro-4-nitrobenzoate |
| InChIKey | AWGXKDKZWXJTFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)