Products 55233-05-1
CAS 55233-05-1 appears in our catalog under these names: tert-Butyl 2-chloro-5-nitrobenzoate, 95%, Tert-butyl 2-chloro-5-nitrobenzoate, 98%, 98%, TERT-BUTYL 2-CHLORO-5-NITROBENZOATE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
Tert-butyl 2-chloro-5-nitrobenzoate (CAS 55233-05-1) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: tert-butyl 2-chloro-5-nitrobenzoate. InChIKey: UCERYJRYDLVOAD-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | tert-butyl 2-chloro-5-nitrobenzoate |
| InChIKey | UCERYJRYDLVOAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)