Products 1537602-93-9
CAS 1537602-93-9 is the registry number for 2-Carbamoylthiazole-4-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
2-carbamoyl-1,3-thiazole-4-carboxylic acid (CAS 1537602-93-9) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 2-carbamoyl-1,3-thiazole-4-carboxylic acid. InChIKey: MVGSEXVAOYPIJC-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-carbamoyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | MVGSEXVAOYPIJC-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)