Products 1537780-98-5
CAS 1537780-98-5 is the registry number for 4-Bromo-2-((trifluoromethyl)sulfonyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-(trifluoromethylsulfonyl)aniline (CAS 1537780-98-5) is a chemical compound with the molecular formula C7H5BrF3NO2S and a molecular weight of 304.09 g/mol. IUPAC name: 4-bromo-2-(trifluoromethylsulfonyl)aniline. InChIKey: SRBXONJFXHDMBH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO2S |
|---|---|
| Molecular weight | 304.09 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethylsulfonyl)aniline |
| InChIKey | SRBXONJFXHDMBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)