Products 214210-15-8
CAS 214210-15-8 is the registry number for 3-Bromo-5-trifluoromethylbenzenesulfonamide, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g.
3-bromo-5-(trifluoromethyl)benzenesulfonamide (CAS 214210-15-8) is a chemical compound with the molecular formula C7H5BrF3NO2S and a molecular weight of 304.09 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)benzenesulfonamide. InChIKey: BGCGGYKHNMWDKE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO2S |
|---|---|
| Molecular weight | 304.09 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)benzenesulfonamide |
| InChIKey | BGCGGYKHNMWDKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)