Products 23384-07-8
CAS 23384-07-8 is the registry number for N-(2-Bromophenyl)-1,1,1-trifluoromethanesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-bromophenyl)-1,1,1-trifluoromethanesulfonamide (CAS 23384-07-8) is a chemical compound with the molecular formula C7H5BrF3NO2S and a molecular weight of 304.09 g/mol. IUPAC name: N-(2-bromophenyl)-1,1,1-trifluoromethanesulfonamide. InChIKey: HWPLNPNFLKPYMT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO2S |
|---|---|
| Molecular weight | 304.09 g/mol |
| IUPAC name | N-(2-bromophenyl)-1,1,1-trifluoromethanesulfonamide |
| InChIKey | HWPLNPNFLKPYMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)