CAS 1537863-78-7 is the registry number for 7-Phenyl-1,2-thiazepane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-phenylthiazepane 1,1-dioxide (CAS 1537863-78-7) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 7-phenylthiazepane 1,1-dioxide. InChIKey: COGDZOZZFRUPAV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 7-phenylthiazepane 1,1-dioxide |
| InChIKey | COGDZOZZFRUPAV-UHFFFAOYSA-N |
| SMILES | C1CCNS(=O)(=O)C(C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)