Products 1537970-07-2
CAS 1537970-07-2 is the registry number for 1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-ol (CAS 1537970-07-2) is a chemical compound with the molecular formula C10H11BrF2O and a molecular weight of 265.09 g/mol. IUPAC name: 1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-ol. InChIKey: SFVWEJHQRMTXLG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2O |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-ol |
| InChIKey | SFVWEJHQRMTXLG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=C(C=C(C=C1F)Br)F)O |
Computed by PubChem (NCBI)