Products 2647887-90-7
CAS 2647887-90-7 is the registry number for 1-(3-Bromophenyl)-1,1-difluoro-2-methylpropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromophenyl)-1,1-difluoro-2-methylpropan-2-ol (CAS 2647887-90-7) is a chemical compound with the molecular formula C10H11BrF2O and a molecular weight of 265.09 g/mol. IUPAC name: 1-(3-bromophenyl)-1,1-difluoro-2-methylpropan-2-ol. InChIKey: DFWGKKZKSPSXJS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2O |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 1-(3-bromophenyl)-1,1-difluoro-2-methylpropan-2-ol |
| InChIKey | DFWGKKZKSPSXJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC(=CC=C1)Br)(F)F)O |
Computed by PubChem (NCBI)