Products 2158642-82-9
CAS 2158642-82-9 is the registry number for 1-Bromo-4-(2,2-difluoropropoxy)-2-methylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-bromo-4-(2,2-difluoropropoxy)-2-methylbenzene (CAS 2158642-82-9) is a chemical compound with the molecular formula C10H11BrF2O and a molecular weight of 265.09 g/mol. IUPAC name: 1-bromo-4-(2,2-difluoropropoxy)-2-methylbenzene. InChIKey: JAKAWNZEXPSWIG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2O |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 1-bromo-4-(2,2-difluoropropoxy)-2-methylbenzene |
| InChIKey | JAKAWNZEXPSWIG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(C)(F)F)Br |
Computed by PubChem (NCBI)