CAS 1538440-91-3 appears in our catalog under these names: 2-Methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid, 95%, 2-Methyl-(1,2,4)triazolo(1,5-a)pyridine-6-carboxylic acid, 2-Methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid 97%, 2-Methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 10g.
2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (CAS 1538440-91-3) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid. InChIKey: GHPWVWLBSQNYIC-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
| InChIKey | GHPWVWLBSQNYIC-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(C=CC2=N1)C(=O)O |
Computed by PubChem (NCBI)