Products 1538514-73-6

CAS 1538514-73-6 is the registry number for 6,7-Dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid (CAS 1538514-73-6) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid. InChIKey: IRBZXFBNTZTOKD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO2
Molecular weight163.17 g/mol
IUPAC name6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid
InChIKeyIRBZXFBNTZTOKD-UHFFFAOYSA-N
SMILESC1CC2=C(C1)C(=NC=C2)C(=O)O

Computed by PubChem (NCBI)