CAS 1538535-25-9 is the registry number for 7-Acetylbenzothiazole. Offered by: TRC. Available pack sizes: 250mg.
1-(1,3-benzothiazol-7-yl)ethanone (CAS 1538535-25-9) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 1-(1,3-benzothiazol-7-yl)ethanone. InChIKey: VXVUBVAFCCVXDL-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-7-yl)ethanone |
| InChIKey | VXVUBVAFCCVXDL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC=C1)N=CS2 |
Computed by PubChem (NCBI)