CAS 153863-61-7 is the registry number for 4,5-Dimethyl-1-phenyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,5-dimethyl-1-phenylpyrazole-3-carboxylic acid (CAS 153863-61-7) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 4,5-dimethyl-1-phenylpyrazole-3-carboxylic acid. InChIKey: XIWXZDZKWRAVLA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 4,5-dimethyl-1-phenylpyrazole-3-carboxylic acid |
| InChIKey | XIWXZDZKWRAVLA-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C(=O)O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)