CAS 1538944-73-8 appears in our catalog under these names: 4,6-Dichloro-2-(1-methoxyethyl)pyrimidine, 95%, 4,6-Dichloro-2-(1-methoxyethyl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,6-dichloro-2-(1-methoxyethyl)pyrimidine (CAS 1538944-73-8) is a chemical compound with the molecular formula C7H8Cl2N2O and a molecular weight of 207.05 g/mol. IUPAC name: 4,6-dichloro-2-(1-methoxyethyl)pyrimidine. InChIKey: JULSPDFQDUUWSL-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | 4,6-dichloro-2-(1-methoxyethyl)pyrimidine |
| InChIKey | JULSPDFQDUUWSL-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CC(=N1)Cl)Cl)OC |
Computed by PubChem (NCBI)