CAS 1803168-09-3 appears in our catalog under these names: Vildagliptin Impurity 44, (2S)-1-(2,2-Dichloroacetyl)-2-pyrrolidinecarbonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(2S)-1-(2,2-dichloroacetyl)pyrrolidine-2-carbonitrile (CAS 1803168-09-3) is a chemical compound with the molecular formula C7H8Cl2N2O and a molecular weight of 207.05 g/mol. IUPAC name: (2S)-1-(2,2-dichloroacetyl)pyrrolidine-2-carbonitrile. InChIKey: DOVNXCPGGLNYDR-YFKPBYRVSA-N.
| Molecular formula | C7H8Cl2N2O |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | (2S)-1-(2,2-dichloroacetyl)pyrrolidine-2-carbonitrile |
| InChIKey | DOVNXCPGGLNYDR-YFKPBYRVSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)C(Cl)Cl)C#N |
Computed by PubChem (NCBI)