Products 929039-11-2

CAS 929039-11-2 is the registry number for 2-Chloro-n-2-pyridinyl-acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

2-chloro-N-pyridin-2-ylacetamide;hydrochloride (CAS 929039-11-2) is a chemical compound with the molecular formula C7H8Cl2N2O and a molecular weight of 207.05 g/mol. IUPAC name: 2-chloro-N-pyridin-2-ylacetamide;hydrochloride. InChIKey: IWHUZGBQJAETDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl2N2O
Molecular weight207.05 g/mol
IUPAC name2-chloro-N-pyridin-2-ylacetamide;hydrochloride
InChIKeyIWHUZGBQJAETDZ-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)NC(=O)CCl.Cl

Computed by PubChem (NCBI)