CAS 1538994-41-0 is the registry number for 1-{6-Methylimidazo(1,2-a)pyridin-2-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanone (CAS 1538994-41-0) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanone. InChIKey: RPDNDVDPLAOFFG-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanone |
| InChIKey | RPDNDVDPLAOFFG-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C(=O)C |
Computed by PubChem (NCBI)