CAS 2816864-54-5 is the registry number for URAT1 inhibitor 13. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-cyclopropyl-1-methylpyrrolo[2,3-c]pyridin-3-yl)-(3,5-dichloro-4-hydroxyphenyl)methanone (CAS 2816864-54-5) is a chemical compound with the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.2 g/mol. IUPAC name: (2-cyclopropyl-1-methylpyrrolo[2,3-c]pyridin-3-yl)-(3,5-dichloro-4-hydroxyphenyl)methanone. InChIKey: TZXCMQLGYIGDOM-UHFFFAOYSA-N.
| Molecular formula | C18H14Cl2N2O2 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | (2-cyclopropyl-1-methylpyrrolo[2,3-c]pyridin-3-yl)-(3,5-dichloro-4-hydroxyphenyl)methanone |
| InChIKey | TZXCMQLGYIGDOM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CN=C2)C(=C1C3CC3)C(=O)C4=CC(=C(C(=C4)Cl)O)Cl |
Computed by PubChem (NCBI)