Products 15397-13-4
CAS 15397-13-4 is the registry number for 3’-beta-C-Methyladenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 15397-13-4) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: MLIWWOXSMXQECL-ZGUVBZSNSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | MLIWWOXSMXQECL-ZGUVBZSNSA-N |
| SMILES | C[C@]1([C@H](O[C@H]([C@@H]1O)N2C=NC3=C(N=CN=C32)N)CO)O |
Computed by PubChem (NCBI)