CAS 1540160-13-1 appears in our catalog under these names: 1-(4-Bromo-2,5-difluorophenyl)-2,2,2-trifluoroethan-1-one, 95%, 95%, 4'-Bromo-2,2,2,2',5'-pentafluoroacetophenone, 95%, 4'-Bromo-2,2,2,2',5'-pentafluoroacetophenone, 97%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-bromo-2,5-difluorophenyl)-2,2,2-trifluoroethanone (CAS 1540160-13-1) is a chemical compound with the molecular formula C8H2BrF5O and a molecular weight of 289.00 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: OUZJGWIUAVFDEL-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF5O |
|---|---|
| Molecular weight | 289.00 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | OUZJGWIUAVFDEL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)