CAS 5122-16-7 is the registry number for Pentafluorophenacyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-1-(2,3,4,5,6-pentafluorophenyl)ethanone (CAS 5122-16-7) is a chemical compound with the molecular formula C8H2BrF5O and a molecular weight of 289.00 g/mol. IUPAC name: 2-bromo-1-(2,3,4,5,6-pentafluorophenyl)ethanone. InChIKey: CIYHGZNFDGHGDK-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF5O |
|---|---|
| Molecular weight | 289.00 g/mol |
| IUPAC name | 2-bromo-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| InChIKey | CIYHGZNFDGHGDK-UHFFFAOYSA-N |
| SMILES | C(C(=O)C1=C(C(=C(C(=C1F)F)F)F)F)Br |
Computed by PubChem (NCBI)