CAS 1980053-04-0 is the registry number for 3-Bromo-2,6-difluoro-5-(trifluoromethyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-2,6-difluoro-5-(trifluoromethyl)benzaldehyde (CAS 1980053-04-0) is a chemical compound with the molecular formula C8H2BrF5O and a molecular weight of 289.00 g/mol. IUPAC name: 3-bromo-2,6-difluoro-5-(trifluoromethyl)benzaldehyde. InChIKey: CRWXNWOJTIFVLC-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF5O |
|---|---|
| Molecular weight | 289.00 g/mol |
| IUPAC name | 3-bromo-2,6-difluoro-5-(trifluoromethyl)benzaldehyde |
| InChIKey | CRWXNWOJTIFVLC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)C=O)F)C(F)(F)F |
Computed by PubChem (NCBI)