CAS 1540603-07-3 is the registry number for 2-Hydroxy-3-mesitylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3-(2,4,6-trimethylphenyl)propanoic acid (CAS 1540603-07-3) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-hydroxy-3-(2,4,6-trimethylphenyl)propanoic acid. InChIKey: XWANCPLFIUGJFR-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-hydroxy-3-(2,4,6-trimethylphenyl)propanoic acid |
| InChIKey | XWANCPLFIUGJFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(C(=O)O)O)C |
Computed by PubChem (NCBI)