Products 1540603-07-3

CAS 1540603-07-3 is the registry number for 2-Hydroxy-3-mesitylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(2,4,6-trimethylphenyl)propanoic acid (CAS 1540603-07-3) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-hydroxy-3-(2,4,6-trimethylphenyl)propanoic acid. InChIKey: XWANCPLFIUGJFR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name2-hydroxy-3-(2,4,6-trimethylphenyl)propanoic acid
InChIKeyXWANCPLFIUGJFR-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)CC(C(=O)O)O)C

Computed by PubChem (NCBI)