Products 1541190-00-4

CAS 1541190-00-4 is the registry number for 2-[(2R,6R)-2,6-Dimethylmorpholin-4-yl]acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetic acid (CAS 1541190-00-4) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetic acid. InChIKey: WKUYTGRCKMDKDV-RNFRBKRXSA-N.

Identity
Molecular formulaC8H15NO3
Molecular weight173.21 g/mol
IUPAC name2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetic acid
InChIKeyWKUYTGRCKMDKDV-RNFRBKRXSA-N
SMILESC[C@@H]1CN(C[C@H](O1)C)CC(=O)O

Computed by PubChem (NCBI)