Products 1541190-36-6

CAS 1541190-36-6 is the registry number for 2-[(2S,6S)-2,6-Dimethylmorpholin-4-yl]acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]acetic acid (CAS 1541190-36-6) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]acetic acid. InChIKey: WKUYTGRCKMDKDV-BQBZGAKWSA-N.

Identity
Molecular formulaC8H15NO3
Molecular weight173.21 g/mol
IUPAC name2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]acetic acid
InChIKeyWKUYTGRCKMDKDV-BQBZGAKWSA-N
SMILESC[C@H]1CN(C[C@@H](O1)C)CC(=O)O

Computed by PubChem (NCBI)