CAS 1541190-36-6 is the registry number for 2-[(2S,6S)-2,6-Dimethylmorpholin-4-yl]acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]acetic acid (CAS 1541190-36-6) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]acetic acid. InChIKey: WKUYTGRCKMDKDV-BQBZGAKWSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]acetic acid |
| InChIKey | WKUYTGRCKMDKDV-BQBZGAKWSA-N |
| SMILES | C[C@H]1CN(C[C@@H](O1)C)CC(=O)O |
Computed by PubChem (NCBI)