Products 1542549-13-2
CAS 1542549-13-2 appears in our catalog under these names: (trans–2–(4–methoxy–3–methylphenyl)cyclopropyl)methanol, (trans-2-(4-methoxy-3-methylphenyl)cyclopropyl)methanol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 500mg.
[(1R,2R)-2-(4-methoxy-3-methylphenyl)cyclopropyl]methanol (CAS 1542549-13-2) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: [(1R,2R)-2-(4-methoxy-3-methylphenyl)cyclopropyl]methanol. InChIKey: RDHXSDUBQHXOPP-QWRGUYRKSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | [(1R,2R)-2-(4-methoxy-3-methylphenyl)cyclopropyl]methanol |
| InChIKey | RDHXSDUBQHXOPP-QWRGUYRKSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H]2C[C@H]2CO)OC |
Computed by PubChem (NCBI)