Products 1542558-35-9
CAS 1542558-35-9 is the registry number for (2-(Pyridin-2-yl)spiro(3.3)heptan-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-pyridin-2-ylspiro[3.3]heptan-2-yl)methanamine (CAS 1542558-35-9) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: (2-pyridin-2-ylspiro[3.3]heptan-2-yl)methanamine. InChIKey: BXVPTSBDOQIYOS-UHFFFAOYSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | (2-pyridin-2-ylspiro[3.3]heptan-2-yl)methanamine |
| InChIKey | BXVPTSBDOQIYOS-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(C2)(CN)C3=CC=CC=N3 |
Computed by PubChem (NCBI)