Products 154257-81-5
CAS 154257-81-5 appears in our catalog under these names: 5–chloro–2–methyl–3–nitrobenzoic acid, 5-Chloro-2-methyl-3-nitrobenzoic acid, 5-Chloro-2-methyl-3-nitrobenzoic acid 95%, 5-Chloro-2-methyl-3-nitrobenzoic acid, 95%, 95%, 5-Chloro-2-methyl-3-nitrobenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100g.
5-chloro-2-methyl-3-nitrobenzoic acid (CAS 154257-81-5) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 5-chloro-2-methyl-3-nitrobenzoic acid. InChIKey: KSLZRIXXMKXDEO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 5-chloro-2-methyl-3-nitrobenzoic acid |
| InChIKey | KSLZRIXXMKXDEO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)