Products 154258-46-5
CAS 154258-46-5 is the registry number for 3-(Dimethylamino)-1-[3-(trifluoromethoxy)phenyl]prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-(dimethylamino)-1-[3-(trifluoromethoxy)phenyl]prop-2-en-1-one (CAS 154258-46-5) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-[3-(trifluoromethoxy)phenyl]prop-2-en-1-one. InChIKey: MLYHTTMXNXRTCX-VOTSOKGWSA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-[3-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| InChIKey | MLYHTTMXNXRTCX-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=CC=C1)OC(F)(F)F |
Computed by PubChem (NCBI)