Products 1589818-99-4
CAS 1589818-99-4 is the registry number for 4-Acetyl-n-(3,3,3-trifluoropropyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-acetyl-N-(3,3,3-trifluoropropyl)benzamide (CAS 1589818-99-4) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: 4-acetyl-N-(3,3,3-trifluoropropyl)benzamide. InChIKey: GFHHDUZPVBAPJZ-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 4-acetyl-N-(3,3,3-trifluoropropyl)benzamide |
| InChIKey | GFHHDUZPVBAPJZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)NCCC(F)(F)F |
Computed by PubChem (NCBI)