CAS 201659-55-4 is the registry number for (3Z)-1,1,1-Trifluoro-4-[(4-methoxyphenyl)amino]pent-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-1,1,1-trifluoro-4-(4-methoxyanilino)pent-3-en-2-one (CAS 201659-55-4) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: (Z)-1,1,1-trifluoro-4-(4-methoxyanilino)pent-3-en-2-one. InChIKey: VJPJVALPZDUGPY-FPLPWBNLSA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | (Z)-1,1,1-trifluoro-4-(4-methoxyanilino)pent-3-en-2-one |
| InChIKey | VJPJVALPZDUGPY-FPLPWBNLSA-N |
| SMILES | C/C(=C/C(=O)C(F)(F)F)/NC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)