CAS 15427-81-3 appears in our catalog under these names: Phenytoin Sodium impurity 5, Phenytoin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-2,2-diphenylacetamide (CAS 15427-81-3) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 2-amino-2,2-diphenylacetamide. InChIKey: HXFAKPJUAWRIIA-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-amino-2,2-diphenylacetamide |
| InChIKey | HXFAKPJUAWRIIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)N)N |
Computed by PubChem (NCBI)