Products 1544861-08-6
CAS 1544861-08-6 appears in our catalog under these names: 5-(2,2-Difluoroethoxy)pyrazine-2-carbonitrile, 98%, 5-(2,2-Difluoroethoxy)pyrazine-2-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
5-(2,2-difluoroethoxy)pyrazine-2-carbonitrile (CAS 1544861-08-6) is a chemical compound with the molecular formula C7H5F2N3O and a molecular weight of 185.13 g/mol. IUPAC name: 5-(2,2-difluoroethoxy)pyrazine-2-carbonitrile. InChIKey: OHDOCUCIEABPIN-UHFFFAOYSA-N.
| Molecular formula | C7H5F2N3O |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 5-(2,2-difluoroethoxy)pyrazine-2-carbonitrile |
| InChIKey | OHDOCUCIEABPIN-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)OCC(F)F)C#N |
Computed by PubChem (NCBI)