CAS 1862740-97-3 is the registry number for 4-(2,2-Difluoroethoxy)pyrimidine-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,2-difluoroethoxy)pyrimidine-5-carbonitrile (CAS 1862740-97-3) is a chemical compound with the molecular formula C7H5F2N3O and a molecular weight of 185.13 g/mol. IUPAC name: 4-(2,2-difluoroethoxy)pyrimidine-5-carbonitrile. InChIKey: HTKLJVOTVKVNQY-UHFFFAOYSA-N.
| Molecular formula | C7H5F2N3O |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 4-(2,2-difluoroethoxy)pyrimidine-5-carbonitrile |
| InChIKey | HTKLJVOTVKVNQY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC=N1)OCC(F)F)C#N |
Computed by PubChem (NCBI)